CAS 2059994-76-0 appears in our catalog under these names: Methyl 4,7-difluoro-1-benzothiophene-2-carboxylate, 95%, Methyl 4,7-difluoro-1-benzothiophene-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 4,7-difluoro-1-benzothiophene-2-carboxylate (CAS 2059994-76-0) is a chemical compound with the molecular formula C10H6F2O2S and a molecular weight of 228.22 g/mol. IUPAC name: methyl 4,7-difluoro-1-benzothiophene-2-carboxylate. InChIKey: MCJQGBYCYITYHR-UHFFFAOYSA-N.
| Molecular formula | C10H6F2O2S |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | methyl 4,7-difluoro-1-benzothiophene-2-carboxylate |
| InChIKey | MCJQGBYCYITYHR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CC(=C2S1)F)F |
Computed by PubChem (NCBI)