CAS 19545-98-3 is the registry number for 2-(2,4,6-Trichloro-3,5-dimethylphenoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetic acid (CAS 19545-98-3) is a chemical compound with the molecular formula C10H9Cl3O3 and a molecular weight of 283.5 g/mol. IUPAC name: 2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetic acid. InChIKey: FQHIEEUNXXZOGU-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl3O3 |
|---|---|
| Molecular weight | 283.5 g/mol |
| IUPAC name | 2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetic acid |
| InChIKey | FQHIEEUNXXZOGU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Cl)OCC(=O)O)Cl)C)Cl |
Computed by PubChem (NCBI)