Products 19545-98-3

CAS 19545-98-3 is the registry number for 2-(2,4,6-Trichloro-3,5-dimethylphenoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetic acid (CAS 19545-98-3) is a chemical compound with the molecular formula C10H9Cl3O3 and a molecular weight of 283.5 g/mol. IUPAC name: 2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetic acid. InChIKey: FQHIEEUNXXZOGU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9Cl3O3
Molecular weight283.5 g/mol
IUPAC name2-(2,4,6-trichloro-3,5-dimethylphenoxy)acetic acid
InChIKeyFQHIEEUNXXZOGU-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=C1Cl)OCC(=O)O)Cl)C)Cl

Computed by PubChem (NCBI)