Products 93-80-1
CAS 93-80-1 is the registry number for 2,4,5-TB. Offered by: Dr. Ehrenstorfer. Available pack sizes: 50mg.
4-(2,4,5-trichlorophenoxy)butanoic acid (CAS 93-80-1) is a chemical compound with the molecular formula C10H9Cl3O3 and a molecular weight of 283.5 g/mol. IUPAC name: 4-(2,4,5-trichlorophenoxy)butanoic acid. InChIKey: RTWCZQFXFMXXKP-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl3O3 |
|---|---|
| Molecular weight | 283.5 g/mol |
| IUPAC name | 4-(2,4,5-trichlorophenoxy)butanoic acid |
| InChIKey | RTWCZQFXFMXXKP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(2,4,5-Trichlorophenoxy)butyric acid, 4-(2,4,5-T)-B /OD/ 4-(2,4,5-trichlorophenoxy)butanoic acid, 2,4,5-T butyric acid, 4-(2,4,5-Trichlorophenoxy)butanoic acid, Butanoic acid, 4-(2,4,5-trichlorophenoxy)-, Butyric acid, 4-(2,4,5-trichlorophenoxy)-, Caswell No. 881X, .gamma.-(2,4,5-Trichlorophenoxy)butyric acid, EPA Pesticide Chemical Code 481800, gamma-(2,4,5-Trichlorophenoxy)butyric acid