Products 1955498-54-0
CAS 1955498-54-0 is the registry number for 4-(3-Methoxyphenyl)-1,3-thiazol-2-amine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(3-methoxyphenyl)-1,3-thiazol-2-amine;hydrobromide (CAS 1955498-54-0) is a chemical compound with the molecular formula C10H11BrN2OS and a molecular weight of 287.18 g/mol. IUPAC name: 4-(3-methoxyphenyl)-1,3-thiazol-2-amine;hydrobromide. InChIKey: XRXGSTPNHHCUDE-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2OS |
|---|---|
| Molecular weight | 287.18 g/mol |
| IUPAC name | 4-(3-methoxyphenyl)-1,3-thiazol-2-amine;hydrobromide |
| InChIKey | XRXGSTPNHHCUDE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CSC(=N2)N.Br |
Computed by PubChem (NCBI)