CAS 937700-23-7 is the registry number for 2-Bromo-N-(3-cyano-4,5-dimethylthiophen-2-yl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-(3-cyano-4,5-dimethylthiophen-2-yl)propanamide (CAS 937700-23-7) is a chemical compound with the molecular formula C10H11BrN2OS and a molecular weight of 287.18 g/mol. IUPAC name: 2-bromo-N-(3-cyano-4,5-dimethylthiophen-2-yl)propanamide. InChIKey: VZMXUQCNOHGXKK-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2OS |
|---|---|
| Molecular weight | 287.18 g/mol |
| IUPAC name | 2-bromo-N-(3-cyano-4,5-dimethylthiophen-2-yl)propanamide |
| InChIKey | VZMXUQCNOHGXKK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C#N)NC(=O)C(C)Br)C |
Computed by PubChem (NCBI)