CAS 1955506-63-4 is the registry number for Methyl 3-((2-cyano-3-methylphenyl)sulfamoyl)-1-benzothiophene-2-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 3-[(2-cyano-3-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate (CAS 1955506-63-4) is a chemical compound with the molecular formula C18H14N2O4S2 and a molecular weight of 386.4 g/mol. IUPAC name: methyl 3-[(2-cyano-3-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate. InChIKey: MLNOGMUMHJURDB-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O4S2 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | methyl 3-[(2-cyano-3-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate |
| InChIKey | MLNOGMUMHJURDB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NS(=O)(=O)C2=C(SC3=CC=CC=C32)C(=O)OC)C#N |
Computed by PubChem (NCBI)