Products 914357-88-3
CAS 914357-88-3 is the registry number for FtsZ-IN-13. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-1-benzothiophene 1,1-dioxide (CAS 914357-88-3) is a chemical compound with the molecular formula C18H14N2O4S2 and a molecular weight of 386.4 g/mol. IUPAC name: 3-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-1-benzothiophene 1,1-dioxide. InChIKey: JJIKZEXOBUFQGZ-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O4S2 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 3-[[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-1-benzothiophene 1,1-dioxide |
| InChIKey | JJIKZEXOBUFQGZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=NN=C(O2)SC3=CS(=O)(=O)C4=CC=CC=C43 |
Computed by PubChem (NCBI)