CAS 1955507-28-4 is the registry number for 2-(Azetidin-3-yl)-5-chloro-4-methylphenol, trifluoroacetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(azetidin-3-yl)-5-chloro-4-methylphenol;2,2,2-trifluoroacetic acid (CAS 1955507-28-4) is a chemical compound with the molecular formula C12H13ClF3NO3 and a molecular weight of 311.68 g/mol. IUPAC name: 2-(azetidin-3-yl)-5-chloro-4-methylphenol;2,2,2-trifluoroacetic acid. InChIKey: HDKUVGKTWXXNHJ-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3NO3 |
|---|---|
| Molecular weight | 311.68 g/mol |
| IUPAC name | 2-(azetidin-3-yl)-5-chloro-4-methylphenol;2,2,2-trifluoroacetic acid |
| InChIKey | HDKUVGKTWXXNHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)O)C2CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)