Products 2279122-60-8

CAS 2279122-60-8 is the registry number for 2-Morpholin-4-yl-5-trifluoromethyl-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-morpholin-4-yl-5-(trifluoromethyl)benzoic acid;hydrochloride (CAS 2279122-60-8) is a chemical compound with the molecular formula C12H13ClF3NO3 and a molecular weight of 311.68 g/mol. IUPAC name: 2-morpholin-4-yl-5-(trifluoromethyl)benzoic acid;hydrochloride. InChIKey: HULSHXZEZZMUHW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13ClF3NO3
Molecular weight311.68 g/mol
IUPAC name2-morpholin-4-yl-5-(trifluoromethyl)benzoic acid;hydrochloride
InChIKeyHULSHXZEZZMUHW-UHFFFAOYSA-N
SMILESC1COCCN1C2=C(C=C(C=C2)C(F)(F)F)C(=O)O.Cl

Computed by PubChem (NCBI)