CAS 2279122-60-8 is the registry number for 2-Morpholin-4-yl-5-trifluoromethyl-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-morpholin-4-yl-5-(trifluoromethyl)benzoic acid;hydrochloride (CAS 2279122-60-8) is a chemical compound with the molecular formula C12H13ClF3NO3 and a molecular weight of 311.68 g/mol. IUPAC name: 2-morpholin-4-yl-5-(trifluoromethyl)benzoic acid;hydrochloride. InChIKey: HULSHXZEZZMUHW-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3NO3 |
|---|---|
| Molecular weight | 311.68 g/mol |
| IUPAC name | 2-morpholin-4-yl-5-(trifluoromethyl)benzoic acid;hydrochloride |
| InChIKey | HULSHXZEZZMUHW-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C(F)(F)F)C(=O)O.Cl |
Computed by PubChem (NCBI)