CAS 1955515-73-7 appears in our catalog under these names: 7,7-Difluoro-1-phenyl-3-azabicyclo(4.1.0)heptane hydrochloride, 95%, 7,7-Difluoro-1-phenyl-3-azabicyclo(4.1.0)heptane hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7,7-difluoro-1-phenyl-3-azabicyclo[4.1.0]heptane;hydrochloride (CAS 1955515-73-7) is a chemical compound with the molecular formula C12H14ClF2N and a molecular weight of 245.69 g/mol. IUPAC name: 7,7-difluoro-1-phenyl-3-azabicyclo[4.1.0]heptane;hydrochloride. InChIKey: ZCCPCZIEGYGQSB-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF2N |
|---|---|
| Molecular weight | 245.69 g/mol |
| IUPAC name | 7,7-difluoro-1-phenyl-3-azabicyclo[4.1.0]heptane;hydrochloride |
| InChIKey | ZCCPCZIEGYGQSB-UHFFFAOYSA-N |
| SMILES | C1CNCC2(C1C2(F)F)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)