CAS 2408970-48-7 is the registry number for (2,2-Difluoro-3-phenylbicyclo[1.1.1]pentan-1-yl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,2-difluoro-3-phenyl-1-bicyclo[1.1.1]pentanyl)methanamine;hydrochloride (CAS 2408970-48-7) is a chemical compound with the molecular formula C12H14ClF2N and a molecular weight of 245.69 g/mol. IUPAC name: (2,2-difluoro-3-phenyl-1-bicyclo[1.1.1]pentanyl)methanamine;hydrochloride. InChIKey: IUIPUUHLUODSAB-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF2N |
|---|---|
| Molecular weight | 245.69 g/mol |
| IUPAC name | (2,2-difluoro-3-phenyl-1-bicyclo[1.1.1]pentanyl)methanamine;hydrochloride |
| InChIKey | IUIPUUHLUODSAB-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2(F)F)C3=CC=CC=C3)CN.Cl |
Computed by PubChem (NCBI)