Products 1955520-10-1

CAS 1955520-10-1 is the registry number for 3-(Piperidin-4-yl)-1H-indole-5-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-piperidin-4-yl-1H-indole-5-carboxylic acid;hydrochloride (CAS 1955520-10-1) is a chemical compound with the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. IUPAC name: 3-piperidin-4-yl-1H-indole-5-carboxylic acid;hydrochloride. InChIKey: GOTQXSODNOEAMF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17ClN2O2
Molecular weight280.75 g/mol
IUPAC name3-piperidin-4-yl-1H-indole-5-carboxylic acid;hydrochloride
InChIKeyGOTQXSODNOEAMF-UHFFFAOYSA-N
SMILESC1CNCCC1C2=CNC3=C2C=C(C=C3)C(=O)O.Cl

Computed by PubChem (NCBI)