Products 1955524-57-8

CAS 1955524-57-8 is the registry number for 2-chloro-n-(6-chloropyridin-3-yl)acetamide hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-chloro-N-(6-chloro-3-pyridinyl)acetamide;hydrochloride (CAS 1955524-57-8) is a chemical compound with the molecular formula C7H7Cl3N2O and a molecular weight of 241.5 g/mol. IUPAC name: 2-chloro-N-(6-chloro-3-pyridinyl)acetamide;hydrochloride. InChIKey: KVOBKZCNWXTMSS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7Cl3N2O
Molecular weight241.5 g/mol
IUPAC name2-chloro-N-(6-chloro-3-pyridinyl)acetamide;hydrochloride
InChIKeyKVOBKZCNWXTMSS-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1NC(=O)CCl)Cl.Cl

Computed by PubChem (NCBI)