CAS 62124-85-0 is the registry number for 1,1,1-Trichloro-3-pyrazin-2-ylpropan-2-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,1,1-trichloro-3-pyrazin-2-ylpropan-2-ol (CAS 62124-85-0) is a chemical compound with the molecular formula C7H7Cl3N2O and a molecular weight of 241.5 g/mol. IUPAC name: 1,1,1-trichloro-3-pyrazin-2-ylpropan-2-ol. InChIKey: GMPLSQQLBNJRAR-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl3N2O |
|---|---|
| Molecular weight | 241.5 g/mol |
| IUPAC name | 1,1,1-trichloro-3-pyrazin-2-ylpropan-2-ol |
| InChIKey | GMPLSQQLBNJRAR-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)CC(C(Cl)(Cl)Cl)O |
Computed by PubChem (NCBI)