Products 1955530-58-1

CAS 1955530-58-1 is the registry number for 5-Bromo-2-chloro-4-fluoroaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.

Structural formula: {0} (CAS {1})

5-bromo-2-chloro-4-fluoroaniline;hydrochloride (CAS 1955530-58-1) is a chemical compound with the molecular formula C6H5BrCl2FN and a molecular weight of 260.92 g/mol. IUPAC name: 5-bromo-2-chloro-4-fluoroaniline;hydrochloride. InChIKey: RWVIPAWJPRCPNP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrCl2FN
Molecular weight260.92 g/mol
IUPAC name5-bromo-2-chloro-4-fluoroaniline;hydrochloride
InChIKeyRWVIPAWJPRCPNP-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Br)F)Cl)N.Cl

Computed by PubChem (NCBI)