CAS 2089381-51-9 appears in our catalog under these names: 3-Bromo-4-(chloromethyl)-5-fluoropyridine hydrochloride, 95%, 3-Bromo-4-(chloromethyl)-5-fluoropyridine hydrochloride, 97%, 3–Bromo–4–(chloromethyl)–5–fluoropyridine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg, 5g.
3-bromo-4-(chloromethyl)-5-fluoropyridine;hydrochloride (CAS 2089381-51-9) is a chemical compound with the molecular formula C6H5BrCl2FN and a molecular weight of 260.92 g/mol. IUPAC name: 3-bromo-4-(chloromethyl)-5-fluoropyridine;hydrochloride. InChIKey: YQMQBMGSEQNSHO-UHFFFAOYSA-N.
| Molecular formula | C6H5BrCl2FN |
|---|---|
| Molecular weight | 260.92 g/mol |
| IUPAC name | 3-bromo-4-(chloromethyl)-5-fluoropyridine;hydrochloride |
| InChIKey | YQMQBMGSEQNSHO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)CCl)F.Cl |
Computed by PubChem (NCBI)