CAS 1955531-02-8 appears in our catalog under these names: 2-(2H-1,3-Benzodioxol-4-yl)-1H-imidazole, 95%, 2-(1,3-Dioxaindan-4-yl)-1H-imidazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(1,3-benzodioxol-4-yl)-1H-imidazole (CAS 1955531-02-8) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 2-(1,3-benzodioxol-4-yl)-1H-imidazole. InChIKey: IXVLHFCWEZXEBA-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-4-yl)-1H-imidazole |
| InChIKey | IXVLHFCWEZXEBA-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=CC(=C2O1)C3=NC=CN3 |
Computed by PubChem (NCBI)