Products 1955541-44-2
CAS 1955541-44-2 is the registry number for 6,6-Dimethoxy-3-(propan-2-yl)-2-azaspiro(3.3)heptan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,6-dimethoxy-1-propan-2-yl-2-azaspiro[3.3]heptan-3-one (CAS 1955541-44-2) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: 6,6-dimethoxy-1-propan-2-yl-2-azaspiro[3.3]heptan-3-one. InChIKey: BQUXVLLODVUBOL-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 6,6-dimethoxy-1-propan-2-yl-2-azaspiro[3.3]heptan-3-one |
| InChIKey | BQUXVLLODVUBOL-UHFFFAOYSA-N |
| SMILES | CC(C)C1C2(CC(C2)(OC)OC)C(=O)N1 |
Computed by PubChem (NCBI)