Products 1955547-78-0

CAS 1955547-78-0 appears in our catalog under these names: 4-Methyl-1h-imidazole-2-carboxylic acid hydrochloride, 95%, 4-Methyl-1H-imidazole-2-carboxylic acid hydrochloride, 98%, 4-Methyl-1H-imidazole-2-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2,5g.

Structural formula: {0} (CAS {1})

5-methyl-1H-imidazole-2-carboxylic acid;hydrochloride (CAS 1955547-78-0) is a chemical compound with the molecular formula C5H7ClN2O2 and a molecular weight of 162.57 g/mol. IUPAC name: 5-methyl-1H-imidazole-2-carboxylic acid;hydrochloride. InChIKey: HXZOPHGQMOIKIA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7ClN2O2
Molecular weight162.57 g/mol
IUPAC name5-methyl-1H-imidazole-2-carboxylic acid;hydrochloride
InChIKeyHXZOPHGQMOIKIA-UHFFFAOYSA-N
SMILESCC1=CN=C(N1)C(=O)O.Cl

Computed by PubChem (NCBI)