Products 2407521-82-6

CAS 2407521-82-6 is the registry number for Methyl 1h-pyrazole-5-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 1H-pyrazole-5-carboxylate;hydrochloride (CAS 2407521-82-6) is a chemical compound with the molecular formula C5H7ClN2O2 and a molecular weight of 162.57 g/mol. IUPAC name: methyl 1H-pyrazole-5-carboxylate;hydrochloride. InChIKey: YSVFFMWRVMFEIW-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7ClN2O2
Molecular weight162.57 g/mol
IUPAC namemethyl 1H-pyrazole-5-carboxylate;hydrochloride
InChIKeyYSVFFMWRVMFEIW-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=NN1.Cl

Computed by PubChem (NCBI)