CAS 1955548-82-9 appears in our catalog under these names: 2-((4-tert-Butylphenyl)methyl)-2-methylpyrrolidine hydrochloride, 95%, 2-((4-tert-Butylphenyl)methyl)-2-methylpyrrolidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[(4-tert-butylphenyl)methyl]-2-methylpyrrolidine;hydrochloride (CAS 1955548-82-9) is a chemical compound with the molecular formula C16H26ClN and a molecular weight of 267.84 g/mol. IUPAC name: 2-[(4-tert-butylphenyl)methyl]-2-methylpyrrolidine;hydrochloride. InChIKey: APBBQKXBUJJRNU-UHFFFAOYSA-N.
| Molecular formula | C16H26ClN |
|---|---|
| Molecular weight | 267.84 g/mol |
| IUPAC name | 2-[(4-tert-butylphenyl)methyl]-2-methylpyrrolidine;hydrochloride |
| InChIKey | APBBQKXBUJJRNU-UHFFFAOYSA-N |
| SMILES | CC1(CCCN1)CC2=CC=C(C=C2)C(C)(C)C.Cl |
Computed by PubChem (NCBI)