CAS 1955548-89-6 is the registry number for tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate hydrate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Tert-butyl 3-fluoro-4-oxopiperidine-1-carboxylate;hydrate (CAS 1955548-89-6) is a chemical compound with the molecular formula C10H18FNO4 and a molecular weight of 235.25 g/mol. IUPAC name: tert-butyl 3-fluoro-4-oxopiperidine-1-carboxylate;hydrate. InChIKey: VZJUORFVYPQUAN-UHFFFAOYSA-N.
| Molecular formula | C10H18FNO4 |
|---|---|
| Molecular weight | 235.25 g/mol |
| IUPAC name | tert-butyl 3-fluoro-4-oxopiperidine-1-carboxylate;hydrate |
| InChIKey | VZJUORFVYPQUAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C1)F.O |
Computed by PubChem (NCBI)