Products 1955548-89-6

CAS 1955548-89-6 is the registry number for tert-Butyl 3-fluoro-4-oxopiperidine-1-carboxylate hydrate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-fluoro-4-oxopiperidine-1-carboxylate;hydrate (CAS 1955548-89-6) is a chemical compound with the molecular formula C10H18FNO4 and a molecular weight of 235.25 g/mol. IUPAC name: tert-butyl 3-fluoro-4-oxopiperidine-1-carboxylate;hydrate. InChIKey: VZJUORFVYPQUAN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18FNO4
Molecular weight235.25 g/mol
IUPAC nametert-butyl 3-fluoro-4-oxopiperidine-1-carboxylate;hydrate
InChIKeyVZJUORFVYPQUAN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(=O)C(C1)F.O

Computed by PubChem (NCBI)