Products 2380464-77-5
CAS 2380464-77-5 is the registry number for Methyl (2S,3R)-2-((tert-butoxycarbonyl)amino)-3-fluorobutanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3R)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 2380464-77-5) is a chemical compound with the molecular formula C10H18FNO4 and a molecular weight of 235.25 g/mol. IUPAC name: methyl (2S,3R)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: WSVXQJFPBANOAI-RNFRBKRXSA-N.
| Molecular formula | C10H18FNO4 |
|---|---|
| Molecular weight | 235.25 g/mol |
| IUPAC name | methyl (2S,3R)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | WSVXQJFPBANOAI-RNFRBKRXSA-N |
| SMILES | C[C@H]([C@H](C(=O)OC)NC(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)