Products 1955561-51-9
CAS 1955561-51-9 is the registry number for tert-Butyl N-(5-chloro-2-(oxolane-3-carbonyl)phenyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl N-[5-chloro-2-(oxolane-3-carbonyl)phenyl]carbamate (CAS 1955561-51-9) is a chemical compound with the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. IUPAC name: tert-butyl N-[5-chloro-2-(oxolane-3-carbonyl)phenyl]carbamate. InChIKey: NJTABZCGXCGQFH-UHFFFAOYSA-N.
| Molecular formula | C16H20ClNO4 |
|---|---|
| Molecular weight | 325.79 g/mol |
| IUPAC name | tert-butyl N-[5-chloro-2-(oxolane-3-carbonyl)phenyl]carbamate |
| InChIKey | NJTABZCGXCGQFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)Cl)C(=O)C2CCOC2 |
Computed by PubChem (NCBI)