CAS 939757-91-2 is the registry number for 1–(tert–Butoxycarbonyl)–4–(3–chlorophenyl)pyrrolidine–3–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
4-(3-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 939757-91-2) is a chemical compound with the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. IUPAC name: 4-(3-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: JWDQWZPPUIYEEZ-UHFFFAOYSA-N.
| Molecular formula | C16H20ClNO4 |
|---|---|
| Molecular weight | 325.79 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | JWDQWZPPUIYEEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)C(=O)O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)