Products 1956306-15-2

CAS 1956306-15-2 is the registry number for 2-(Butyl(ethyl)amino)-2-phenylacetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-[butyl(ethyl)amino]-2-phenylacetic acid;hydrochloride (CAS 1956306-15-2) is a chemical compound with the molecular formula C14H22ClNO2 and a molecular weight of 271.78 g/mol. IUPAC name: 2-[butyl(ethyl)amino]-2-phenylacetic acid;hydrochloride. InChIKey: VIOCPYDIWVCGCH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22ClNO2
Molecular weight271.78 g/mol
IUPAC name2-[butyl(ethyl)amino]-2-phenylacetic acid;hydrochloride
InChIKeyVIOCPYDIWVCGCH-UHFFFAOYSA-N
SMILESCCCCN(CC)C(C1=CC=CC=C1)C(=O)O.Cl

Computed by PubChem (NCBI)