CAS 401916-47-0 appears in our catalog under these names: (R)-3-Amino-4-(4-tert-butyl-phenyl)-butyric acid hydrochloride, 95%, (R)-3-Amino-4-(4-(tert-butyl)phenyl)butanoic acid hydrochloride, 98%, (R)-3-Amino-4-(4-(tert-butyl)phenyl)butanoic acid hydrochloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3R)-3-amino-4-(4-tert-butylphenyl)butanoic acid;hydrochloride (CAS 401916-47-0) is a chemical compound with the molecular formula C14H22ClNO2 and a molecular weight of 271.78 g/mol. IUPAC name: (3R)-3-amino-4-(4-tert-butylphenyl)butanoic acid;hydrochloride. InChIKey: NPVGFMZLBRNQHM-UTONKHPSSA-N.
| Molecular formula | C14H22ClNO2 |
|---|---|
| Molecular weight | 271.78 g/mol |
| IUPAC name | (3R)-3-amino-4-(4-tert-butylphenyl)butanoic acid;hydrochloride |
| InChIKey | NPVGFMZLBRNQHM-UTONKHPSSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)