Products 1956326-86-5
CAS 1956326-86-5 is the registry number for 2-Bromo-7-(trifluoromethyl)thieno[3,2-c]pyridin-4(5h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-7-(trifluoromethyl)-5H-thieno[3,2-c]pyridin-4-one (CAS 1956326-86-5) is a chemical compound with the molecular formula C8H3BrF3NOS and a molecular weight of 298.08 g/mol. IUPAC name: 2-bromo-7-(trifluoromethyl)-5H-thieno[3,2-c]pyridin-4-one. InChIKey: UHOADJDNWGVZRN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NOS |
|---|---|
| Molecular weight | 298.08 g/mol |
| IUPAC name | 2-bromo-7-(trifluoromethyl)-5H-thieno[3,2-c]pyridin-4-one |
| InChIKey | UHOADJDNWGVZRN-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=O)NC=C2C(F)(F)F)Br |
Computed by PubChem (NCBI)