Products 238742-91-1
CAS 238742-91-1 appears in our catalog under these names: 4-Bromo-2-(trifluoromethoxy)phenyl isothiocyanate, 95%, 4-Bromo-2-trifluoromethoxyphenyl isothiocyanate, 97.0%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g.
4-bromo-1-isothiocyanato-2-(trifluoromethoxy)benzene (CAS 238742-91-1) is a chemical compound with the molecular formula C8H3BrF3NOS and a molecular weight of 298.08 g/mol. IUPAC name: 4-bromo-1-isothiocyanato-2-(trifluoromethoxy)benzene. InChIKey: VXHDHMUZXWITDG-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NOS |
|---|---|
| Molecular weight | 298.08 g/mol |
| IUPAC name | 4-bromo-1-isothiocyanato-2-(trifluoromethoxy)benzene |
| InChIKey | VXHDHMUZXWITDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)OC(F)(F)F)N=C=S |
Computed by PubChem (NCBI)