Products 1956354-65-6

CAS 1956354-65-6 is the registry number for 2-(Cyclopropylmethoxy)-5-(ethylsulfonyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 250mg.

Structural formula: {0} (CAS {1})

2-(cyclopropylmethoxy)-5-ethylsulfonylbenzoic acid (CAS 1956354-65-6) is a chemical compound with the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. IUPAC name: 2-(cyclopropylmethoxy)-5-ethylsulfonylbenzoic acid. InChIKey: LNXVQKIDXKPFEH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O5S
Molecular weight284.33 g/mol
IUPAC name2-(cyclopropylmethoxy)-5-ethylsulfonylbenzoic acid
InChIKeyLNXVQKIDXKPFEH-UHFFFAOYSA-N
SMILESCCS(=O)(=O)C1=CC(=C(C=C1)OCC2CC2)C(=O)O

Computed by PubChem (NCBI)