CAS 344338-13-2 appears in our catalog under these names: Methyl 3-{[(4-methylbenzene)sulfonyl]oxy}cyclobutane-1-carboxylate, 97%, Methyl 3-{((4-methylbenzene)sulfonyl)oxy}cyclobutane-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
Methyl 3-(4-methylphenyl)sulfonyloxycyclobutane-1-carboxylate (CAS 344338-13-2) is a chemical compound with the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. IUPAC name: methyl 3-(4-methylphenyl)sulfonyloxycyclobutane-1-carboxylate. InChIKey: RDQSYEXHPDZATH-UHFFFAOYSA-N.
| Molecular formula | C13H16O5S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | methyl 3-(4-methylphenyl)sulfonyloxycyclobutane-1-carboxylate |
| InChIKey | RDQSYEXHPDZATH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CC(C2)C(=O)OC |
Computed by PubChem (NCBI)