Products 1956354-83-8
CAS 1956354-83-8 is the registry number for 4-(4-Amino-2-fluorophenoxy)pyrimidin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
4-(4-amino-2-fluorophenoxy)pyrimidin-2-amine (CAS 1956354-83-8) is a chemical compound with the molecular formula C10H9FN4O and a molecular weight of 220.20 g/mol. IUPAC name: 4-(4-amino-2-fluorophenoxy)pyrimidin-2-amine. InChIKey: HUYPRFFXQDWKLA-UHFFFAOYSA-N.
| Molecular formula | C10H9FN4O |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | 4-(4-amino-2-fluorophenoxy)pyrimidin-2-amine |
| InChIKey | HUYPRFFXQDWKLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)F)OC2=NC(=NC=C2)N |
Computed by PubChem (NCBI)