Products 51516-69-9

CAS 51516-69-9 is the registry number for 5-Amino-1-(4-fluorophenyl)-1H-pyrazole-4-carboxamide. Offered by: TRC, Biosynth. Available pack sizes: 5g, 0,1g, 0,25g, 0,5g, 1g, 2g.

Structural formula: {0} (CAS {1})

5-amino-1-(4-fluorophenyl)pyrazole-4-carboxamide (CAS 51516-69-9) is a chemical compound with the molecular formula C10H9FN4O and a molecular weight of 220.20 g/mol. IUPAC name: 5-amino-1-(4-fluorophenyl)pyrazole-4-carboxamide. InChIKey: AXZGQTXCRLLNIN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9FN4O
Molecular weight220.20 g/mol
IUPAC name5-amino-1-(4-fluorophenyl)pyrazole-4-carboxamide
InChIKeyAXZGQTXCRLLNIN-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N2C(=C(C=N2)C(=O)N)N)F

Computed by PubChem (NCBI)