CAS 51516-69-9 is the registry number for 5-Amino-1-(4-fluorophenyl)-1H-pyrazole-4-carboxamide. Offered by: TRC, Biosynth. Available pack sizes: 5g, 0,1g, 0,25g, 0,5g, 1g, 2g.
5-amino-1-(4-fluorophenyl)pyrazole-4-carboxamide (CAS 51516-69-9) is a chemical compound with the molecular formula C10H9FN4O and a molecular weight of 220.20 g/mol. IUPAC name: 5-amino-1-(4-fluorophenyl)pyrazole-4-carboxamide. InChIKey: AXZGQTXCRLLNIN-UHFFFAOYSA-N.
| Molecular formula | C10H9FN4O |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | 5-amino-1-(4-fluorophenyl)pyrazole-4-carboxamide |
| InChIKey | AXZGQTXCRLLNIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=C(C=N2)C(=O)N)N)F |
Computed by PubChem (NCBI)