Products 1956354-93-0
CAS 1956354-93-0 is the registry number for (((2-Chloro-5-nitro-1,4-phenylene)bis(oxy))bis(methylene))dibenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-chloro-4-nitro-2,5-bis(phenylmethoxy)benzene (CAS 1956354-93-0) is a chemical compound with the molecular formula C20H16ClNO4 and a molecular weight of 369.8 g/mol. IUPAC name: 1-chloro-4-nitro-2,5-bis(phenylmethoxy)benzene. InChIKey: RXLMXKYWJFUIQJ-UHFFFAOYSA-N.
| Molecular formula | C20H16ClNO4 |
|---|---|
| Molecular weight | 369.8 g/mol |
| IUPAC name | 1-chloro-4-nitro-2,5-bis(phenylmethoxy)benzene |
| InChIKey | RXLMXKYWJFUIQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2[N+](=O)[O-])OCC3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)