Products 36519-61-6
CAS 36519-61-6 appears in our catalog under these names: 10-Methyl-9-phenylacridinium perchlorate, 98%, 10–Methyl–9–phenylacridinium Perchlorate, 10-Methyl-9-phenylacridinium Perchlorate, >98.0%(HPLC)(N), 10-Methyl-9-phenylacridin-10-ium perchlorate 98%, 10-Methyl-9-phenylacridinium Perchlorate, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
10-methyl-9-phenylacridin-10-ium perchlorate (CAS 36519-61-6) is a chemical compound with the molecular formula C20H16ClNO4 and a molecular weight of 369.8 g/mol. IUPAC name: 10-methyl-9-phenylacridin-10-ium perchlorate. InChIKey: NRNCXGCGIKATGE-UHFFFAOYSA-M.
| Molecular formula | C20H16ClNO4 |
|---|---|
| Molecular weight | 369.8 g/mol |
| IUPAC name | 10-methyl-9-phenylacridin-10-ium perchlorate |
| InChIKey | NRNCXGCGIKATGE-UHFFFAOYSA-M |
| SMILES | C[N+]1=C2C=CC=CC2=C(C3=CC=CC=C31)C4=CC=CC=C4.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)