CAS 1956356-14-1 is the registry number for 2,3-Dimethyl-6-(trifluoromethyl)-3H-imidazo(4,5-b)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,3-dimethyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine (CAS 1956356-14-1) is a chemical compound with the molecular formula C9H8F3N3 and a molecular weight of 215.17 g/mol. IUPAC name: 2,3-dimethyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine. InChIKey: ZJEGGRFEEABHDP-UHFFFAOYSA-N.
| Molecular formula | C9H8F3N3 |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 2,3-dimethyl-6-(trifluoromethyl)imidazo[4,5-b]pyridine |
| InChIKey | ZJEGGRFEEABHDP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)N=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)