Products 2097963-33-0
CAS 2097963-33-0 is the registry number for 1-(Cyclopropylmethyl)-3-(trifluoromethyl)-1H-pyrazole-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 1000mg.
1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazole-5-carbonitrile (CAS 2097963-33-0) is a chemical compound with the molecular formula C9H8F3N3 and a molecular weight of 215.17 g/mol. IUPAC name: 1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazole-5-carbonitrile. InChIKey: ZDKKXRZIZYBCKO-UHFFFAOYSA-N.
| Molecular formula | C9H8F3N3 |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazole-5-carbonitrile |
| InChIKey | ZDKKXRZIZYBCKO-UHFFFAOYSA-N |
| SMILES | C1CC1CN2C(=CC(=N2)C(F)(F)F)C#N |
Computed by PubChem (NCBI)