Products 1956379-76-2
CAS 1956379-76-2 appears in our catalog under these names: 6-(1-Cyanocyclopropyl)nicotinic acid, 95%, 6-(1-Cyanocyclopropyl)nicotinic acid, 97%, 6-(1-Cyanocyclopropyl)nicotinic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
6-(1-cyanocyclopropyl)pyridine-3-carboxylic acid (CAS 1956379-76-2) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 6-(1-cyanocyclopropyl)pyridine-3-carboxylic acid. InChIKey: ONTIWIZQZQPCLP-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 6-(1-cyanocyclopropyl)pyridine-3-carboxylic acid |
| InChIKey | ONTIWIZQZQPCLP-UHFFFAOYSA-N |
| SMILES | C1CC1(C#N)C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)