CAS 1956382-50-5 appears in our catalog under these names: 4-(Benzyloxy)-6-bromopyridin-2-ol, 4-(Benzyloxy)-6-bromopyridin-2-ol 97%. Offered by: TRC, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-bromo-4-phenylmethoxy-1H-pyridin-2-one (CAS 1956382-50-5) is a chemical compound with the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. IUPAC name: 6-bromo-4-phenylmethoxy-1H-pyridin-2-one. InChIKey: HLTGVZGDLQGXAR-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2 |
|---|---|
| Molecular weight | 280.12 g/mol |
| IUPAC name | 6-bromo-4-phenylmethoxy-1H-pyridin-2-one |
| InChIKey | HLTGVZGDLQGXAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=O)NC(=C2)Br |
Computed by PubChem (NCBI)