CAS 1956436-71-7 is the registry number for (R)-tert-Butyl 2-(4-bromophenyl)-6-oxopiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl (2R)-2-(4-bromophenyl)-6-oxopiperidine-1-carboxylate (CAS 1956436-71-7) is a chemical compound with the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. IUPAC name: tert-butyl (2R)-2-(4-bromophenyl)-6-oxopiperidine-1-carboxylate. InChIKey: LLDNBVJWAXFLOP-CYBMUJFWSA-N.
| Molecular formula | C16H20BrNO3 |
|---|---|
| Molecular weight | 354.24 g/mol |
| IUPAC name | tert-butyl (2R)-2-(4-bromophenyl)-6-oxopiperidine-1-carboxylate |
| InChIKey | LLDNBVJWAXFLOP-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCCC1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)