CAS 2868258-96-0 is the registry number for Benzyl (3S,4S)-3-(2-bromoacetyl)-4-ethylpyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (3S,4S)-3-(2-bromoacetyl)-4-ethylpyrrolidine-1-carboxylate (CAS 2868258-96-0) is a chemical compound with the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. IUPAC name: benzyl (3S,4S)-3-(2-bromoacetyl)-4-ethylpyrrolidine-1-carboxylate. InChIKey: QEFUCTKHMXMWRF-ZIAGYGMSSA-N.
| Molecular formula | C16H20BrNO3 |
|---|---|
| Molecular weight | 354.24 g/mol |
| IUPAC name | benzyl (3S,4S)-3-(2-bromoacetyl)-4-ethylpyrrolidine-1-carboxylate |
| InChIKey | QEFUCTKHMXMWRF-ZIAGYGMSSA-N |
| SMILES | CC[C@@H]1CN(C[C@H]1C(=O)CBr)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)