Products 1956436-75-1
CAS 1956436-75-1 is the registry number for (S)-4-(tert-Butoxy)-2-(4-chlorophenyl)-4-oxobutanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 1956436-75-1) is a chemical compound with the molecular formula C14H17ClO4 and a molecular weight of 284.73 g/mol. IUPAC name: (2S)-2-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: COSMWXJSTCFAEJ-NSHDSACASA-N.
| Molecular formula | C14H17ClO4 |
|---|---|
| Molecular weight | 284.73 g/mol |
| IUPAC name | (2S)-2-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | COSMWXJSTCFAEJ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)