CAS 790271-11-3 is the registry number for (2E)-3-(3-Chloro-4-isobutoxy-5-methoxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoic acid (CAS 790271-11-3) is a chemical compound with the molecular formula C14H17ClO4 and a molecular weight of 284.73 g/mol. IUPAC name: (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoic acid. InChIKey: YTYZKOPTJUDXGV-SNAWJCMRSA-N.
| Molecular formula | C14H17ClO4 |
|---|---|
| Molecular weight | 284.73 g/mol |
| IUPAC name | (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoic acid |
| InChIKey | YTYZKOPTJUDXGV-SNAWJCMRSA-N |
| SMILES | CC(C)COC1=C(C=C(C=C1Cl)/C=C/C(=O)O)OC |
Computed by PubChem (NCBI)