CAS 1803609-06-4 is the registry number for 1,5-Dimethyl 3-(4-chlorophenyl)-3-methylpentanedioate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Dimethyl 3-(4-chlorophenyl)-3-methylpentanedioate (CAS 1803609-06-4) is a chemical compound with the molecular formula C14H17ClO4 and a molecular weight of 284.73 g/mol. IUPAC name: dimethyl 3-(4-chlorophenyl)-3-methylpentanedioate. InChIKey: PUIVUKTZMWRRKF-UHFFFAOYSA-N.
| Molecular formula | C14H17ClO4 |
|---|---|
| Molecular weight | 284.73 g/mol |
| IUPAC name | dimethyl 3-(4-chlorophenyl)-3-methylpentanedioate |
| InChIKey | PUIVUKTZMWRRKF-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)OC)(CC(=O)OC)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)