Products 1803609-06-4

CAS 1803609-06-4 is the registry number for 1,5-Dimethyl 3-(4-chlorophenyl)-3-methylpentanedioate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Dimethyl 3-(4-chlorophenyl)-3-methylpentanedioate (CAS 1803609-06-4) is a chemical compound with the molecular formula C14H17ClO4 and a molecular weight of 284.73 g/mol. IUPAC name: dimethyl 3-(4-chlorophenyl)-3-methylpentanedioate. InChIKey: PUIVUKTZMWRRKF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17ClO4
Molecular weight284.73 g/mol
IUPAC namedimethyl 3-(4-chlorophenyl)-3-methylpentanedioate
InChIKeyPUIVUKTZMWRRKF-UHFFFAOYSA-N
SMILESCC(CC(=O)OC)(CC(=O)OC)C1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)