Products 1958100-57-6
CAS 1958100-57-6 appears in our catalog under these names: 5-(tert-Butyl)pyrimidin-2-amine hydrochloride, 95%, 5-(tert-Butyl)pyrimidin-2-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-tert-butylpyrimidin-2-amine;hydrochloride (CAS 1958100-57-6) is a chemical compound with the molecular formula C8H14ClN3 and a molecular weight of 187.67 g/mol. IUPAC name: 5-tert-butylpyrimidin-2-amine;hydrochloride. InChIKey: NPNMZCOJCMJAFF-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3 |
|---|---|
| Molecular weight | 187.67 g/mol |
| IUPAC name | 5-tert-butylpyrimidin-2-amine;hydrochloride |
| InChIKey | NPNMZCOJCMJAFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN=C(N=C1)N.Cl |
Computed by PubChem (NCBI)