CAS 1248446-47-0 appears in our catalog under these names: 1-(tert-Butyl)-4-chloro-3-methyl-1h-pyrazol-5-amine, 95%, 1–(tert–Butyl)–4–chloro–3–methyl–1H–pyrazol–5–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
1-tert-butyl-4-chloro-3-methylpyrazol-5-amine (CAS 1248446-47-0) is a chemical compound with the molecular formula C8H14ClN3 and a molecular weight of 187.67 g/mol. IUPAC name: 1-tert-butyl-4-chloro-3-methylpyrazol-5-amine. InChIKey: ZZAQVPKNUVBBJC-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3 |
|---|---|
| Molecular weight | 187.67 g/mol |
| IUPAC name | 1-tert-butyl-4-chloro-3-methylpyrazol-5-amine |
| InChIKey | ZZAQVPKNUVBBJC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1Cl)N)C(C)(C)C |
Computed by PubChem (NCBI)