CAS 195873-64-4 is the registry number for (2R,3R,4S)-2,3,4-Tris(benzyloxy)hex-5-en-1-ol, 95%. Offered by: Ambeed. Available pack sizes: 1g, 100mg, 250mg.
(2R,3R,4S)-2,3,4-tris(phenylmethoxy)hex-5-en-1-ol (CAS 195873-64-4) is a chemical compound with the molecular formula C27H30O4 and a molecular weight of 418.5 g/mol. IUPAC name: (2R,3R,4S)-2,3,4-tris(phenylmethoxy)hex-5-en-1-ol. InChIKey: NTOSGFLXZNOARL-OYUWMTPXSA-N.
| Molecular formula | C27H30O4 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | (2R,3R,4S)-2,3,4-tris(phenylmethoxy)hex-5-en-1-ol |
| InChIKey | NTOSGFLXZNOARL-OYUWMTPXSA-N |
| SMILES | C=C[C@@H]([C@H]([C@@H](CO)OCC1=CC=CC=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)