CAS 4954-17-0 appears in our catalog under these names: Estradiol Benzoate Impurity 8 (Estradiol Benzoate EP Impurity H), Estradiol benzoate impurity 2. Offered by: Hubei YoungXin, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
[(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (CAS 4954-17-0) is a chemical compound with the molecular formula C27H30O4 and a molecular weight of 418.5 g/mol. IUPAC name: [(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate. InChIKey: CRJBVQYNQZNAOQ-RYIFMDQWSA-N.
| Molecular formula | C27H30O4 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | [(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| InChIKey | CRJBVQYNQZNAOQ-RYIFMDQWSA-N |
| SMILES | CC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)OC(=O)C5=CC=CC=C5)C |
Computed by PubChem (NCBI)