Products 1959556-60-5
CAS 1959556-60-5 is the registry number for tert-Butyl 2-(4-(methoxycarbonyl)phenyl)-2,6-dihydropyrrolo[3,4-c]pyrazole-5(4H)-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2-(4-methoxycarbonylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylate (CAS 1959556-60-5) is a chemical compound with the molecular formula C18H21N3O4 and a molecular weight of 343.4 g/mol. IUPAC name: tert-butyl 2-(4-methoxycarbonylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylate. InChIKey: AJEBYEIUATYOAK-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O4 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | tert-butyl 2-(4-methoxycarbonylphenyl)-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylate |
| InChIKey | AJEBYEIUATYOAK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CN(N=C2C1)C3=CC=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)