Products 823215-50-5
CAS 823215-50-5 is the registry number for Methyl 3-amino-5-(2-((tert-butoxycarbonyl)amino)pyridin-4-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]benzoate (CAS 823215-50-5) is a chemical compound with the molecular formula C18H21N3O4 and a molecular weight of 343.4 g/mol. IUPAC name: methyl 3-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]benzoate. InChIKey: XQDRUAGBWCOAKN-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O4 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | methyl 3-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]benzoate |
| InChIKey | XQDRUAGBWCOAKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=CC(=C1)C2=CC(=CC(=C2)N)C(=O)OC |
Computed by PubChem (NCBI)